C16H19BrN4O — CID 109263792
N-(4-bromophenyl)-2-(pentylamino)pyrimidine-5-carboxamide (PubChem CID 109263792) has the molecular formula C16H19BrN4O and a molecular weight of 363.26 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-(pentylamino)pyrimidine-5-carboxamide.
| Compound Name | N-(4-bromophenyl)-2-(pentylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109263792 |
| Molecular Formula | C16H19BrN4O |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-(4-bromophenyl)-2-(pentylamino)pyrimidine-5-carboxamide |
| SMILES | CCCCCNc1ncc(C(=O)Nc2ccc(Br)cc2)cn1 |
| InChI | InChI=1S/C16H19BrN4O/c1-2-3-4-9-18-16-19-10-12(11-20-16)15(22)21-14-7-5-13(17)6-8-14/h5-8,10-11H,2-4,9H2,1H3,(H,21,22)(H,18,19,20) |
| InChIKey | VUJHPXDQCMMRKE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|