C17H22N4O — CID 109263756
N-(2-methylphenyl)-2-(pentylamino)pyrimidine-5-carboxamide (PubChem CID 109263756) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-(pentylamino)pyrimidine-5-carboxamide.
| Compound Name | N-(2-methylphenyl)-2-(pentylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109263756 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | N-(2-methylphenyl)-2-(pentylamino)pyrimidine-5-carboxamide |
| SMILES | CCCCCNc1ncc(C(=O)Nc2ccccc2C)cn1 |
| InChI | InChI=1S/C17H22N4O/c1-3-4-7-10-18-17-19-11-14(12-20-17)16(22)21-15-9-6-5-8-13(15)2/h5-6,8-9,11-12H,3-4,7,10H2,1-2H3,(H,21,22)(H,18,19,20) |
| InChIKey | ZKIXELCNYUBWMF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|