C16H18Cl2N4O — CID 109263849
N-(2,3-dichlorophenyl)-2-(pentylamino)pyrimidine-5-carboxamide (PubChem CID 109263849) has the molecular formula C16H18Cl2N4O and a molecular weight of 353.25 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(pentylamino)pyrimidine-5-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(pentylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109263849 |
| Molecular Formula | C16H18Cl2N4O |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(pentylamino)pyrimidine-5-carboxamide |
| SMILES | CCCCCNc1ncc(C(=O)Nc2cccc(Cl)c2Cl)cn1 |
| InChI | InChI=1S/C16H18Cl2N4O/c1-2-3-4-8-19-16-20-9-11(10-21-16)15(23)22-13-7-5-6-12(17)14(13)18/h5-7,9-10H,2-4,8H2,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | DGAULRUSRLVNRJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|