C16H20N4O — CID 109246763
N-(2,5-dimethylphenyl)-2-(propylamino)pyrimidine-5-carboxamide (PubChem CID 109246763) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-(propylamino)pyrimidine-5-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-(propylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109246763 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-(propylamino)pyrimidine-5-carboxamide |
| SMILES | CCCNc1ncc(C(=O)Nc2cc(C)ccc2C)cn1 |
| InChI | InChI=1S/C16H20N4O/c1-4-7-17-16-18-9-13(10-19-16)15(21)20-14-8-11(2)5-6-12(14)3/h5-6,8-10H,4,7H2,1-3H3,(H,20,21)(H,17,18,19) |
| InChIKey | VWZADDUJKKEDPX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |