C16H19N3O — CID 104639934
N-(2,5-dimethylphenyl)-5-(ethylamino)pyridine-2-carboxamide (PubChem CID 104639934) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-5-(ethylamino)pyridine-2-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-5-(ethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104639934 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N-(2,5-dimethylphenyl)-5-(ethylamino)pyridine-2-carboxamide |
| SMILES | CCNc1ccc(C(=O)Nc2cc(C)ccc2C)nc1 |
| InChI | InChI=1S/C16H19N3O/c1-4-17-13-7-8-14(18-10-13)16(20)19-15-9-11(2)5-6-12(15)3/h5-10,17H,4H2,1-3H3,(H,19,20) |
| InChIKey | UWLXEZXKFGKLJZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |