C18H23N3O — CID 109195188
5-(tert-butylamino)-N-(2,5-dimethylphenyl)pyridine-2-carboxamide (PubChem CID 109195188) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 5-(tert-butylamino)-N-(2,5-dimethylphenyl)pyridine-2-carboxamide.
| Compound Name | 5-(tert-butylamino)-N-(2,5-dimethylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109195188 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 5-(tert-butylamino)-N-(2,5-dimethylphenyl)pyridine-2-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2ccc(NC(C)(C)C)cn2)c1 |
| InChI | InChI=1S/C18H23N3O/c1-12-6-7-13(2)16(10-12)20-17(22)15-9-8-14(11-19-15)21-18(3,4)5/h6-11,21H,1-5H3,(H,20,22) |
| InChIKey | MHCAVXFAOIFYJE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |