C20H32N2O2 — CID 108966394
N-(4-tert-butylphenyl)-2,2-dimethyl-N'-pentylpropanediamide (PubChem CID 108966394) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2,2-dimethyl-N'-pentylpropanediamide.
| Compound Name | N-(4-tert-butylphenyl)-2,2-dimethyl-N'-pentylpropanediamide |
|---|---|
| PubChem CID | 108966394 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | N-(4-tert-butylphenyl)-2,2-dimethyl-N'-pentylpropanediamide |
| SMILES | CCCCCNC(=O)C(C)(C)C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H32N2O2/c1-7-8-9-14-21-17(23)20(5,6)18(24)22-16-12-10-15(11-13-16)19(2,3)4/h10-13H,7-9,14H2,1-6H3,(H,21,23)(H,22,24) |
| InChIKey | BYLORBJNKODUQM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|