C19H31N3O4 — CID 58419108
N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dimethyl-N'-(4-methylphenyl)propanediamide (PubChem CID 58419108) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dimethyl-N'-(4-methylphenyl)propanediamide.
| Compound Name | N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dimethyl-N'-(4-methylphenyl)propanediamide |
|---|---|
| PubChem CID | 58419108 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2-dimethyl-N'-(4-methylphenyl)propanediamide |
| SMILES | Cc1ccc(NC(=O)C(C)(C)C(=O)NCCCN(CCO)CCO)cc1 |
| InChI | InChI=1S/C19H31N3O4/c1-15-5-7-16(8-6-15)21-18(26)19(2,3)17(25)20-9-4-10-22(11-13-23)12-14-24/h5-8,23-24H,4,9-14H2,1-3H3,(H,20,25)(H,21,26) |
| InChIKey | FJJHGAANZKHRGO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|