C19H29N3O4 — CID 108960648
ethyl 4-[[3-[3-(dimethylamino)propylamino]-2,2-dimethyl-3-oxopropanoyl]amino]benzoate (PubChem CID 108960648) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is ethyl 4-[[3-[3-(dimethylamino)propylamino]-2,2-dimethyl-3-oxopropanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-[3-(dimethylamino)propylamino]-2,2-dimethyl-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108960648 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | ethyl 4-[[3-[3-(dimethylamino)propylamino]-2,2-dimethyl-3-oxopropanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C)(C)C(=O)NCCCN(C)C)cc1 |
| InChI | InChI=1S/C19H29N3O4/c1-6-26-16(23)14-8-10-15(11-9-14)21-18(25)19(2,3)17(24)20-12-7-13-22(4)5/h8-11H,6-7,12-13H2,1-5H3,(H,20,24)(H,21,25) |
| InChIKey | OHLLINLGHYACJH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|