C17H22N2O4 — CID 108957736
ethyl 4-[[2,2-dimethyl-3-oxo-3-(prop-2-enylamino)propanoyl]amino]benzoate (PubChem CID 108957736) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is ethyl 4-[[2,2-dimethyl-3-oxo-3-(prop-2-enylamino)propanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[2,2-dimethyl-3-oxo-3-(prop-2-enylamino)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108957736 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | ethyl 4-[[2,2-dimethyl-3-oxo-3-(prop-2-enylamino)propanoyl]amino]benzoate |
| SMILES | C=CCNC(=O)C(C)(C)C(=O)Nc1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C17H22N2O4/c1-5-11-18-15(21)17(3,4)16(22)19-13-9-7-12(8-10-13)14(20)23-6-2/h5,7-10H,1,6,11H2,2-4H3,(H,18,21)(H,19,22) |
| InChIKey | SJJSYWNMDLPCPS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|