C16H22N2O2 — CID 108957663
N-(3,4-dimethylphenyl)-2,2-dimethyl-N'-prop-2-enylpropanediamide (PubChem CID 108957663) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2,2-dimethyl-N'-prop-2-enylpropanediamide.
| Compound Name | N-(3,4-dimethylphenyl)-2,2-dimethyl-N'-prop-2-enylpropanediamide |
|---|---|
| PubChem CID | 108957663 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2,2-dimethyl-N'-prop-2-enylpropanediamide |
| SMILES | C=CCNC(=O)C(C)(C)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H22N2O2/c1-6-9-17-14(19)16(4,5)15(20)18-13-8-7-11(2)12(3)10-13/h6-8,10H,1,9H2,2-5H3,(H,17,19)(H,18,20) |
| InChIKey | JYTXRTRVXXRWFD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|