C17H26N2O2 — CID 108965699
N'-(3,4-dimethylphenyl)-N,N-diethyl-2,2-dimethylpropanediamide (PubChem CID 108965699) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N'-(3,4-dimethylphenyl)-N,N-diethyl-2,2-dimethylpropanediamide.
| Compound Name | N'-(3,4-dimethylphenyl)-N,N-diethyl-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108965699 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N'-(3,4-dimethylphenyl)-N,N-diethyl-2,2-dimethylpropanediamide |
| SMILES | CCN(CC)C(=O)C(C)(C)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H26N2O2/c1-7-19(8-2)16(21)17(5,6)15(20)18-14-10-9-12(3)13(4)11-14/h9-11H,7-8H2,1-6H3,(H,18,20) |
| InChIKey | IZYKCLRQDKOXQN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|