C13H16N2O5 — CID 63645091
2-[carboxymethyl-[(3,4-dimethylphenyl)carbamoyl]amino]acetic acid (PubChem CID 63645091) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[carboxymethyl-[(3,4-dimethylphenyl)carbamoyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(3,4-dimethylphenyl)carbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 63645091 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[carboxymethyl-[(3,4-dimethylphenyl)carbamoyl]amino]acetic acid |
| SMILES | Cc1ccc(NC(=O)N(CC(=O)O)CC(=O)O)cc1C |
| InChI | InChI=1S/C13H16N2O5/c1-8-3-4-10(5-9(8)2)14-13(20)15(6-11(16)17)7-12(18)19/h3-5H,6-7H2,1-2H3,(H,14,20)(H,16,17)(H,18,19) |
| InChIKey | MGRHGZUSUZVZEY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |