C13H18N2O2 — CID 144808255
N-[(3,4-dimethylphenyl)carbamoyl]-N-methylpropanamide (PubChem CID 144808255) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)carbamoyl]-N-methylpropanamide.
| Compound Name | N-[(3,4-dimethylphenyl)carbamoyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 144808255 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-[(3,4-dimethylphenyl)carbamoyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H18N2O2/c1-5-12(16)15(4)13(17)14-11-7-6-9(2)10(3)8-11/h6-8H,5H2,1-4H3,(H,14,17) |
| InChIKey | MNJLCTVIQFCCOA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |