C12H17N — CID 142248146
N-but-1-en-2-yl-3,4-dimethylaniline (PubChem CID 142248146) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is N-but-1-en-2-yl-3,4-dimethylaniline.
| Compound Name | N-but-1-en-2-yl-3,4-dimethylaniline |
|---|---|
| PubChem CID | 142248146 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-but-1-en-2-yl-3,4-dimethylaniline |
| SMILES | C=C(CC)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C12H17N/c1-5-11(4)13-12-7-6-9(2)10(3)8-12/h6-8,13H,4-5H2,1-3H3 |
| InChIKey | HIIOVLMABKORLP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |