C15H21N3O3 — CID 102561459
N-(3,4-dimethylphenyl)-2-[2-(2-methylbutanoyl)hydrazinyl]-2-oxoacetamide (PubChem CID 102561459) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[2-(2-methylbutanoyl)hydrazinyl]-2-oxoacetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[2-(2-methylbutanoyl)hydrazinyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 102561459 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[2-(2-methylbutanoyl)hydrazinyl]-2-oxoacetamide |
| SMILES | CCC(C)C(=O)NNC(=O)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H21N3O3/c1-5-9(2)13(19)17-18-15(21)14(20)16-12-7-6-10(3)11(4)8-12/h6-9H,5H2,1-4H3,(H,16,20)(H,17,19)(H,18,21) |
| InChIKey | GRMLRRSJZNLDHJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|