C14H20N2O2 — CID 3102423
N'-butan-2-yl-N-(3,4-dimethylphenyl)oxamide (PubChem CID 3102423) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N'-butan-2-yl-N-(3,4-dimethylphenyl)oxamide.
| Compound Name | N'-butan-2-yl-N-(3,4-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 3102423 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N'-butan-2-yl-N-(3,4-dimethylphenyl)oxamide |
| SMILES | CCC(C)NC(=O)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H20N2O2/c1-5-11(4)15-13(17)14(18)16-12-7-6-9(2)10(3)8-12/h6-8,11H,5H2,1-4H3,(H,15,17)(H,16,18) |
| InChIKey | JJJNJXHDTMQBEK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|