C13H17N3O3 — CID 45001357
N'-butan-2-yl-N-(4-carbamoylphenyl)oxamide (PubChem CID 45001357) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N'-butan-2-yl-N-(4-carbamoylphenyl)oxamide.
| Compound Name | N'-butan-2-yl-N-(4-carbamoylphenyl)oxamide |
|---|---|
| PubChem CID | 45001357 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N'-butan-2-yl-N-(4-carbamoylphenyl)oxamide |
| SMILES | CCC(C)NC(=O)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C13H17N3O3/c1-3-8(2)15-12(18)13(19)16-10-6-4-9(5-7-10)11(14)17/h4-8H,3H2,1-2H3,(H2,14,17)(H,15,18)(H,16,19) |
| InChIKey | ASYGFDQWCOJAQX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|