C11H12N2O — CID 2345033
2-cyano-N-(3,4-dimethylphenyl)acetamide (PubChem CID 2345033) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-cyano-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-cyano-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 2345033 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-cyano-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC#N)cc1C |
| InChI | InChI=1S/C11H12N2O/c1-8-3-4-10(7-9(8)2)13-11(14)5-6-12/h3-4,7H,5H2,1-2H3,(H,13,14) |
| InChIKey | IOVXWSZVPOVPHF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |