C10H10N2O — CID 4056837
1-cyano-N-(3,4-dimethylphenyl)formamide (PubChem CID 4056837) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-cyano-N-(3,4-dimethylphenyl)formamide.
| Compound Name | 1-cyano-N-(3,4-dimethylphenyl)formamide |
|---|---|
| PubChem CID | 4056837 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 1-cyano-N-(3,4-dimethylphenyl)formamide |
| SMILES | Cc1ccc(NC(=O)C#N)cc1C |
| InChI | InChI=1S/C10H10N2O/c1-7-3-4-9(5-8(7)2)12-10(13)6-11/h3-5H,1-2H3,(H,12,13) |
| InChIKey | QPVGVGODCGMOKX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|