C17H16N2O — CID 82179426
4-(cyanomethyl)-N-(3,4-dimethylphenyl)benzamide (PubChem CID 82179426) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-(cyanomethyl)-N-(3,4-dimethylphenyl)benzamide.
| Compound Name | 4-(cyanomethyl)-N-(3,4-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 82179426 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-(cyanomethyl)-N-(3,4-dimethylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CC#N)cc2)cc1C |
| InChI | InChI=1S/C17H16N2O/c1-12-3-8-16(11-13(12)2)19-17(20)15-6-4-14(5-7-15)9-10-18/h3-8,11H,9H2,1-2H3,(H,19,20) |
| InChIKey | WJLPZBJSQLWFRO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |