C15H12N2O3 — CID 103955439
N-[4-(cyanomethyl)phenyl]-3,4-dihydroxybenzamide (PubChem CID 103955439) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-3,4-dihydroxybenzamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 103955439 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-3,4-dihydroxybenzamide |
| SMILES | N#CCc1ccc(NC(=O)c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C15H12N2O3/c16-8-7-10-1-4-12(5-2-10)17-15(20)11-3-6-13(18)14(19)9-11/h1-6,9,18-19H,7H2,(H,17,20) |
| InChIKey | KXBQILCLYDRSHG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|