C17H14N2O4 — CID 57264454
4-(cyanomethyl)-N-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]benzamide (PubChem CID 57264454) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 4-(cyanomethyl)-N-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]benzamide.
| Compound Name | 4-(cyanomethyl)-N-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 57264454 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-(cyanomethyl)-N-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]benzamide |
| SMILES | N#CCc1ccc(C(=O)NCC(=O)c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C17H14N2O4/c18-8-7-11-1-3-12(4-2-11)17(23)19-10-16(22)13-5-6-14(20)15(21)9-13/h1-6,9,20-21H,7,10H2,(H,19,23) |
| InChIKey | MWVFYACUTZUPRJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|