C15H11BrN2O2 — CID 60598960
4-bromo-N-[4-(cyanomethyl)phenyl]-2-hydroxybenzamide (PubChem CID 60598960) has the molecular formula C15H11BrN2O2 and a molecular weight of 331.17 g/mol. Its IUPAC name is 4-bromo-N-[4-(cyanomethyl)phenyl]-2-hydroxybenzamide.
| Compound Name | 4-bromo-N-[4-(cyanomethyl)phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 60598960 |
| Molecular Formula | C15H11BrN2O2 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 4-bromo-N-[4-(cyanomethyl)phenyl]-2-hydroxybenzamide |
| SMILES | N#CCc1ccc(NC(=O)c2ccc(Br)cc2O)cc1 |
| InChI | InChI=1S/C15H11BrN2O2/c16-11-3-6-13(14(19)9-11)15(20)18-12-4-1-10(2-5-12)7-8-17/h1-6,9,19H,7H2,(H,18,20) |
| InChIKey | UKSXBGOPFOBRFR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |