C10H9BrN2O2 — CID 55210646
4-bromo-N-(2-cyanoethyl)-2-hydroxybenzamide (PubChem CID 55210646) has the molecular formula C10H9BrN2O2 and a molecular weight of 269.10 g/mol. Its IUPAC name is 4-bromo-N-(2-cyanoethyl)-2-hydroxybenzamide.
| Compound Name | 4-bromo-N-(2-cyanoethyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 55210646 |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 4-bromo-N-(2-cyanoethyl)-2-hydroxybenzamide |
| SMILES | N#CCCNC(=O)c1ccc(Br)cc1O |
| InChI | InChI=1S/C10H9BrN2O2/c11-7-2-3-8(9(14)6-7)10(15)13-5-1-4-12/h2-3,6,14H,1,5H2,(H,13,15) |
| InChIKey | GKGDTYHIDMNLMO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|