C10H8Br2N2O — CID 107168327
3,5-dibromo-N-(2-cyanoethyl)benzamide (PubChem CID 107168327) has the molecular formula C10H8Br2N2O and a molecular weight of 332.00 g/mol. Its IUPAC name is 3,5-dibromo-N-(2-cyanoethyl)benzamide.
| Compound Name | 3,5-dibromo-N-(2-cyanoethyl)benzamide |
|---|---|
| PubChem CID | 107168327 |
| Molecular Formula | C10H8Br2N2O |
| Molecular Weight | 332.00 g/mol |
| Exact Mass | 329.90 |
| IUPAC Name | 3,5-dibromo-N-(2-cyanoethyl)benzamide |
| SMILES | N#CCCNC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C10H8Br2N2O/c11-8-4-7(5-9(12)6-8)10(15)14-3-1-2-13/h4-6H,1,3H2,(H,14,15) |
| InChIKey | CJDBTFVMHSYCEH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.00 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|