C9H9Br2NOS — CID 118586538
3,5-dibromo-N-(2-sulfanylethyl)benzamide (PubChem CID 118586538) has the molecular formula C9H9Br2NOS and a molecular weight of 339.05 g/mol. Its IUPAC name is 3,5-dibromo-N-(2-sulfanylethyl)benzamide.
| Compound Name | 3,5-dibromo-N-(2-sulfanylethyl)benzamide |
|---|---|
| PubChem CID | 118586538 |
| Molecular Formula | C9H9Br2NOS |
| Molecular Weight | 339.05 g/mol |
| Exact Mass | 336.88 |
| IUPAC Name | 3,5-dibromo-N-(2-sulfanylethyl)benzamide |
| SMILES | O=C(NCCS)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C9H9Br2NOS/c10-7-3-6(4-8(11)5-7)9(13)12-1-2-14/h3-5,14H,1-2H2,(H,12,13) |
| InChIKey | VLDUGZJLHJMZNS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.05 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|