C9H8Cl3NOS — CID 154170548
3,4,5-trichloro-N-(2-sulfanylethyl)benzamide (PubChem CID 154170548) has the molecular formula C9H8Cl3NOS and a molecular weight of 284.60 g/mol. Its IUPAC name is 3,4,5-trichloro-N-(2-sulfanylethyl)benzamide.
| Compound Name | 3,4,5-trichloro-N-(2-sulfanylethyl)benzamide |
|---|---|
| PubChem CID | 154170548 |
| Molecular Formula | C9H8Cl3NOS |
| Molecular Weight | 284.60 g/mol |
| Exact Mass | 282.94 |
| IUPAC Name | 3,4,5-trichloro-N-(2-sulfanylethyl)benzamide |
| SMILES | O=C(NCCS)c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl3NOS/c10-6-3-5(4-7(11)8(6)12)9(14)13-1-2-15/h3-4,15H,1-2H2,(H,13,14) |
| InChIKey | MRPINLYTPGPSAX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|