C12H16Cl2N2O — CID 82786165
4-amino-3,5-dichloro-N-pentylbenzamide (PubChem CID 82786165) has the molecular formula C12H16Cl2N2O and a molecular weight of 275.18 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-pentylbenzamide.
| Compound Name | 4-amino-3,5-dichloro-N-pentylbenzamide |
|---|---|
| PubChem CID | 82786165 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-amino-3,5-dichloro-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O/c1-2-3-4-5-16-12(17)8-6-9(13)11(15)10(14)7-8/h6-7H,2-5,15H2,1H3,(H,16,17) |
| InChIKey | LWAMBFIYJULYOT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|