C10H13Cl2NOS — CID 110190675
4,5-dichloro-N-pentylthiophene-2-carboxamide (PubChem CID 110190675) has the molecular formula C10H13Cl2NOS and a molecular weight of 266.19 g/mol. Its IUPAC name is 4,5-dichloro-N-pentylthiophene-2-carboxamide.
| Compound Name | 4,5-dichloro-N-pentylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 110190675 |
| Molecular Formula | C10H13Cl2NOS |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 4,5-dichloro-N-pentylthiophene-2-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C10H13Cl2NOS/c1-2-3-4-5-13-10(14)8-6-7(11)9(12)15-8/h6H,2-5H2,1H3,(H,13,14) |
| InChIKey | UWQPUVJYLSIAAE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|