C13H21Cl2NO2S — CID 110190536
4,5-dichlorothiophene-2-carboxylate;octylazanium (PubChem CID 110190536) has the molecular formula C13H21Cl2NO2S and a molecular weight of 326.29 g/mol. Its IUPAC name is 4,5-dichlorothiophene-2-carboxylate;octylazanium.
| Compound Name | 4,5-dichlorothiophene-2-carboxylate;octylazanium |
|---|---|
| PubChem CID | 110190536 |
| Molecular Formula | C13H21Cl2NO2S |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 4,5-dichlorothiophene-2-carboxylate;octylazanium |
| SMILES | CCCCCCCC[NH3+].O=C([O-])c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C8H19N.C5H2Cl2O2S/c1-2-3-4-5-6-7-8-9;6-2-1-3(5(8)9)10-4(2)7/h2-9H2,1H3;1H,(H,8,9) |
| InChIKey | AZDZYGAOXASCNM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|