C11H17Cl2NO5S — CID 110190523
4,5-dichlorothiophene-2-carboxylate;tris(2-hydroxyethyl)azanium (PubChem CID 110190523) has the molecular formula C11H17Cl2NO5S and a molecular weight of 346.23 g/mol. Its IUPAC name is 4,5-dichlorothiophene-2-carboxylate;tris(2-hydroxyethyl)azanium.
| Compound Name | 4,5-dichlorothiophene-2-carboxylate;tris(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 110190523 |
| Molecular Formula | C11H17Cl2NO5S |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 4,5-dichlorothiophene-2-carboxylate;tris(2-hydroxyethyl)azanium |
| SMILES | O=C([O-])c1cc(Cl)c(Cl)s1.OCC[NH+](CCO)CCO |
| InChI | InChI=1S/C6H15NO3.C5H2Cl2O2S/c8-4-1-7(2-5-9)3-6-10;6-2-1-3(5(8)9)10-4(2)7/h8-10H,1-6H2;1H,(H,8,9) |
| InChIKey | HXNMAUMIVVBKCT-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |