C7H6BrO2S- — CID 7019239
4-bromo-5-ethylthiophene-2-carboxylate (PubChem CID 7019239) has the molecular formula C7H6BrO2S- and a molecular weight of 234.09 g/mol. Its IUPAC name is 4-bromo-5-ethylthiophene-2-carboxylate.
| Compound Name | 4-bromo-5-ethylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7019239 |
| Molecular Formula | C7H6BrO2S- |
| Molecular Weight | 234.09 g/mol |
| Exact Mass | 232.93 |
| IUPAC Name | 4-bromo-5-ethylthiophene-2-carboxylate |
| SMILES | CCc1sc(C(=O)[O-])cc1Br |
| InChI | InChI=1S/C7H7BrO2S/c1-2-5-4(8)3-6(11-5)7(9)10/h3H,2H2,1H3,(H,9,10)/p-1 |
| InChIKey | IRDAEUDNKBRCAE-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.09 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |