C8H10BrN3OS — CID 679383
[(4-bromo-5-ethylthiophen-2-yl)methylideneamino]urea (PubChem CID 679383) has the molecular formula C8H10BrN3OS and a molecular weight of 276.16 g/mol. Its IUPAC name is [(4-bromo-5-ethylthiophen-2-yl)methylideneamino]urea.
| Compound Name | [(4-bromo-5-ethylthiophen-2-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 679383 |
| Molecular Formula | C8H10BrN3OS |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 274.97 |
| IUPAC Name | [(4-bromo-5-ethylthiophen-2-yl)methylideneamino]urea |
| SMILES | CCc1sc(C=NNC(N)=O)cc1Br |
| InChI | InChI=1S/C8H10BrN3OS/c1-2-7-6(9)3-5(14-7)4-11-12-8(10)13/h3-4H,2H2,1H3,(H3,10,12,13) |
| InChIKey | XJQPHULAQYZRPL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|