C10H12BrN3O3 — CID 135851177
[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]urea (PubChem CID 135851177) has the molecular formula C10H12BrN3O3 and a molecular weight of 302.13 g/mol. Its IUPAC name is [(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]urea.
| Compound Name | [(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 135851177 |
| Molecular Formula | C10H12BrN3O3 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | [(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]urea |
| SMILES | CCOc1cc(/C=N/NC(N)=O)cc(Br)c1O |
| InChI | InChI=1S/C10H12BrN3O3/c1-2-17-8-4-6(3-7(11)9(8)15)5-13-14-10(12)16/h3-5,15H,2H2,1H3,(H3,12,14,16)/b13-5+ |
| InChIKey | XYYQKUKFIICKRW-WLRTZDKTSA-N |
| XLogP | 1.56 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|