C11H12BrN3O4 — CID 135433204
N'-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]oxamide (PubChem CID 135433204) has the molecular formula C11H12BrN3O4 and a molecular weight of 330.14 g/mol. Its IUPAC name is N'-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]oxamide.
| Compound Name | N'-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 135433204 |
| Molecular Formula | C11H12BrN3O4 |
| Molecular Weight | 330.14 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | N'-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]oxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(N)=O)cc(Br)c1O |
| InChI | InChI=1S/C11H12BrN3O4/c1-2-19-8-4-6(3-7(12)9(8)16)5-14-15-11(18)10(13)17/h3-5,16H,2H2,1H3,(H2,13,17)(H,15,18)/b14-5+ |
| InChIKey | WGCFOSRAWHJGDQ-LHHJGKSTSA-N |
| XLogP | 0.49 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.14 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|