C12H14BrN3O4 — CID 9120919
N'-[(Z)-(3-bromo-5-ethoxy-4-methoxyphenyl)methylideneamino]oxamide (PubChem CID 9120919) has the molecular formula C12H14BrN3O4 and a molecular weight of 344.17 g/mol. Its IUPAC name is N'-[(Z)-(3-bromo-5-ethoxy-4-methoxyphenyl)methylideneamino]oxamide.
| Compound Name | N'-[(Z)-(3-bromo-5-ethoxy-4-methoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 9120919 |
| Molecular Formula | C12H14BrN3O4 |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | N'-[(Z)-(3-bromo-5-ethoxy-4-methoxyphenyl)methylideneamino]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(N)=O)cc(Br)c1OC |
| InChI | InChI=1S/C12H14BrN3O4/c1-3-20-9-5-7(4-8(13)10(9)19-2)6-15-16-12(18)11(14)17/h4-6H,3H2,1-2H3,(H2,14,17)(H,16,18)/b15-6- |
| InChIKey | RGMWMKHITBVBSG-UUASQNMZSA-N |
| XLogP | 0.79 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|