C14H18BrN3O4S — CID 168535693
ethyl 2-[2-bromo-4-[(carbamothioylhydrazinylidene)methyl]-6-ethoxyphenoxy]acetate (PubChem CID 168535693) has the molecular formula C14H18BrN3O4S and a molecular weight of 404.29 g/mol. Its IUPAC name is ethyl 2-[2-bromo-4-[(carbamothioylhydrazinylidene)methyl]-6-ethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-4-[(carbamothioylhydrazinylidene)methyl]-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 168535693 |
| Molecular Formula | C14H18BrN3O4S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | ethyl 2-[2-bromo-4-[(carbamothioylhydrazinylidene)methyl]-6-ethoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(C=NNC(N)=S)cc1OCC |
| InChI | InChI=1S/C14H18BrN3O4S/c1-3-20-11-6-9(7-17-18-14(16)23)5-10(15)13(11)22-8-12(19)21-4-2/h5-7H,3-4,8H2,1-2H3,(H3,16,18,23) |
| InChIKey | BIOBDAYMVJHCRP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|