C13H16BrNO5 — CID 57361037
ethyl 2-[2-bromo-6-ethoxy-4-(hydroxyiminomethyl)phenoxy]acetate (PubChem CID 57361037) has the molecular formula C13H16BrNO5 and a molecular weight of 346.18 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-ethoxy-4-(hydroxyiminomethyl)phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-ethoxy-4-(hydroxyiminomethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 57361037 |
| Molecular Formula | C13H16BrNO5 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | ethyl 2-[2-bromo-6-ethoxy-4-(hydroxyiminomethyl)phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(C=NO)cc1OCC |
| InChI | InChI=1S/C13H16BrNO5/c1-3-18-11-6-9(7-15-17)5-10(14)13(11)20-8-12(16)19-4-2/h5-7,17H,3-4,8H2,1-2H3 |
| InChIKey | KAMOSQJQHNNZFB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|