C16H17BrN2O6 — CID 6163934
ethyl 2-[2-bromo-4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-6-ethoxyphenoxy]acetate (PubChem CID 6163934) has the molecular formula C16H17BrN2O6 and a molecular weight of 413.22 g/mol. Its IUPAC name is ethyl 2-[2-bromo-4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-6-ethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 6163934 |
| Molecular Formula | C16H17BrN2O6 |
| Molecular Weight | 413.22 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | ethyl 2-[2-bromo-4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-6-ethoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(/C=C2/NC(=O)NC2=O)cc1OCC |
| InChI | InChI=1S/C16H17BrN2O6/c1-3-23-12-7-9(6-11-15(21)19-16(22)18-11)5-10(17)14(12)25-8-13(20)24-4-2/h5-7H,3-4,8H2,1-2H3,(H2,18,19,21,22)/b11-6+ |
| InChIKey | LENCNJIYTVRHDS-IZZDOVSWSA-N |
| XLogP | 1.97 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|