C23H21Br2N3O6 — CID 126012123
N-(2-bromo-4,5-dimethylphenyl)-2-[2-bromo-6-ethoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 126012123) has the molecular formula C23H21Br2N3O6 and a molecular weight of 595.24 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethylphenyl)-2-[2-bromo-6-ethoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(2-bromo-4,5-dimethylphenyl)-2-[2-bromo-6-ethoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126012123 |
| Molecular Formula | C23H21Br2N3O6 |
| Molecular Weight | 595.24 g/mol |
| Exact Mass | 592.98 |
| IUPAC Name | N-(2-bromo-4,5-dimethylphenyl)-2-[2-bromo-6-ethoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(C=C2C(=O)NC(=O)NC2=O)cc(Br)c1OCC(=O)Nc1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C23H21Br2N3O6/c1-4-33-18-9-13(7-14-21(30)27-23(32)28-22(14)31)8-16(25)20(18)34-10-19(29)26-17-6-12(3)11(2)5-15(17)24/h5-9H,4,10H2,1-3H3,(H,26,29)(H2,27,28,30,31,32) |
| InChIKey | DWYMAWWAODZHPZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|