C14H11BrN2O7 — CID 50871454
2-[2-bromo-6-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid (PubChem CID 50871454) has the molecular formula C14H11BrN2O7 and a molecular weight of 399.15 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 50871454 |
| Molecular Formula | C14H11BrN2O7 |
| Molecular Weight | 399.15 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid |
| SMILES | COc1cc(C=C2C(=O)NC(=O)NC2=O)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C14H11BrN2O7/c1-23-9-4-6(3-8(15)11(9)24-5-10(18)19)2-7-12(20)16-14(22)17-13(7)21/h2-4H,5H2,1H3,(H,18,19)(H2,16,17,20,21,22) |
| InChIKey | NIINQIBJUVMKGI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.15 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|