C14H12BrN3O5S — CID 126233017
2-[2-bromo-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-methoxyphenoxy]acetamide (PubChem CID 126233017) has the molecular formula C14H12BrN3O5S and a molecular weight of 414.24 g/mol. Its IUPAC name is 2-[2-bromo-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[2-bromo-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126233017 |
| Molecular Formula | C14H12BrN3O5S |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | 2-[2-bromo-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C=C2C(=O)NC(=S)NC2=O)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C14H12BrN3O5S/c1-22-9-4-6(3-8(15)11(9)23-5-10(16)19)2-7-12(20)17-14(24)18-13(7)21/h2-4H,5H2,1H3,(H2,16,19)(H2,17,18,20,21,24) |
| InChIKey | XFAYFCTWYNKMFH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|