C21H17BrClN3O6 — CID 126226206
2-[2-bromo-4-[(E)-[1-(5-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]acetamide (PubChem CID 126226206) has the molecular formula C21H17BrClN3O6 and a molecular weight of 522.74 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-[1-(5-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[2-bromo-4-[(E)-[1-(5-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126226206 |
| Molecular Formula | C21H17BrClN3O6 |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 521.00 |
| IUPAC Name | 2-[2-bromo-4-[(E)-[1-(5-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3cc(Cl)ccc3C)C2=O)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C21H17BrClN3O6/c1-10-3-4-12(23)8-15(10)26-20(29)13(19(28)25-21(26)30)5-11-6-14(22)18(16(7-11)31-2)32-9-17(24)27/h3-8H,9H2,1-2H3,(H2,24,27)(H,25,28,30)/b13-5+ |
| InChIKey | SPGVPUQHTUDBKR-WLRTZDKTSA-N |
| XLogP | 2.95 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|