C20H13Cl3N2O6 — CID 126076200
2-[2,6-dichloro-4-[(E)-[1-(5-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126076200) has the molecular formula C20H13Cl3N2O6 and a molecular weight of 483.69 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(E)-[1-(5-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dichloro-4-[(E)-[1-(5-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126076200 |
| Molecular Formula | C20H13Cl3N2O6 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | 2-[2,6-dichloro-4-[(E)-[1-(5-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(Cl)cc1N1C(=O)NC(=O)/C(=C\c2cc(Cl)c(OCC(=O)O)c(Cl)c2)C1=O |
| InChI | InChI=1S/C20H13Cl3N2O6/c1-9-2-3-11(21)7-15(9)25-19(29)12(18(28)24-20(25)30)4-10-5-13(22)17(14(23)6-10)31-8-16(26)27/h2-7H,8H2,1H3,(H,26,27)(H,24,28,30)/b12-4+ |
| InChIKey | WXOGBRMAWGNARN-UUILKARUSA-N |
| XLogP | 4.09 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|