C19H10Cl4N2O6 — CID 126070238
2-[2,6-dichloro-4-[(E)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126070238) has the molecular formula C19H10Cl4N2O6 and a molecular weight of 504.11 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(E)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dichloro-4-[(E)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126070238 |
| Molecular Formula | C19H10Cl4N2O6 |
| Molecular Weight | 504.11 g/mol |
| Exact Mass | 501.93 |
| IUPAC Name | 2-[2,6-dichloro-4-[(E)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Cl)cc(/C=C2\C(=O)NC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)cc1Cl |
| InChI | InChI=1S/C19H10Cl4N2O6/c20-11-2-1-9(6-12(11)21)25-18(29)10(17(28)24-19(25)30)3-8-4-13(22)16(14(23)5-8)31-7-15(26)27/h1-6H,7H2,(H,26,27)(H,24,28,30)/b10-3+ |
| InChIKey | AEOGAWQHLGJFMM-XCVCLJGOSA-N |
| XLogP | 4.43 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.11 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|