C22H19Cl3N2O4 — CID 126050546
(5E)-1-(3-chloro-4-methylphenyl)-5-[[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126050546) has the molecular formula C22H19Cl3N2O4 and a molecular weight of 481.76 g/mol. Its IUPAC name is (5E)-1-(3-chloro-4-methylphenyl)-5-[[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(3-chloro-4-methylphenyl)-5-[[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126050546 |
| Molecular Formula | C22H19Cl3N2O4 |
| Molecular Weight | 481.76 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | (5E)-1-(3-chloro-4-methylphenyl)-5-[[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(N2C(=O)NC(=O)/C(=C\c3cc(Cl)c(OCC(C)C)c(Cl)c3)C2=O)cc1Cl |
| InChI | InChI=1S/C22H19Cl3N2O4/c1-11(2)10-31-19-17(24)7-13(8-18(19)25)6-15-20(28)26-22(30)27(21(15)29)14-5-4-12(3)16(23)9-14/h4-9,11H,10H2,1-3H3,(H,26,28,30)/b15-6+ |
| InChIKey | AXVWIFDNPAHTBO-GIDUJCDVSA-N |
| XLogP | 5.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.76 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|