C21H15BrCl2N2O6 — CID 21169093
ethyl 2-[4-[(Z)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,6-dichlorophenoxy]acetate (PubChem CID 21169093) has the molecular formula C21H15BrCl2N2O6 and a molecular weight of 542.17 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,6-dichlorophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,6-dichlorophenoxy]acetate |
|---|---|
| PubChem CID | 21169093 |
| Molecular Formula | C21H15BrCl2N2O6 |
| Molecular Weight | 542.17 g/mol |
| Exact Mass | 539.95 |
| IUPAC Name | ethyl 2-[4-[(Z)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,6-dichlorophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2/C(=O)NC(=O)N(c3ccc(Br)cc3)C2=O)cc1Cl |
| InChI | InChI=1S/C21H15BrCl2N2O6/c1-2-31-17(27)10-32-18-15(23)8-11(9-16(18)24)7-14-19(28)25-21(30)26(20(14)29)13-5-3-12(22)4-6-13/h3-9H,2,10H2,1H3,(H,25,28,30)/b14-7- |
| InChIKey | SATUDUAOLKHNDF-AUWJEWJLSA-N |
| XLogP | 4.36 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.17 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|