C29H26BrClN2O6 — CID 98208449
(5Z)-1-(4-bromophenyl)-5-[[3-chloro-4-[2-(2,6-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 98208449) has the molecular formula C29H26BrClN2O6 and a molecular weight of 613.89 g/mol. Its IUPAC name is (5Z)-1-(4-bromophenyl)-5-[[3-chloro-4-[2-(2,6-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(4-bromophenyl)-5-[[3-chloro-4-[2-(2,6-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 98208449 |
| Molecular Formula | C29H26BrClN2O6 |
| Molecular Weight | 613.89 g/mol |
| Exact Mass | 612.07 |
| IUPAC Name | (5Z)-1-(4-bromophenyl)-5-[[3-chloro-4-[2-(2,6-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(/C=C2/C(=O)NC(=O)N(c3ccc(Br)cc3)C2=O)cc(Cl)c1OCCOc1c(C)cccc1C |
| InChI | InChI=1S/C29H26BrClN2O6/c1-4-37-24-16-19(15-23(31)26(24)39-13-12-38-25-17(2)6-5-7-18(25)3)14-22-27(34)32-29(36)33(28(22)35)21-10-8-20(30)9-11-21/h5-11,14-16H,4,12-13H2,1-3H3,(H,32,34,36)/b22-14- |
| InChIKey | ALKRPEAUDIXKAT-HMAPJEAMSA-N |
| XLogP | 6.24 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.89 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|