C22H18BrClN2O7 — CID 124533408
ethyl 2-[4-[(E)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-chloro-6-methoxyphenoxy]acetate (PubChem CID 124533408) has the molecular formula C22H18BrClN2O7 and a molecular weight of 537.75 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-chloro-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-chloro-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 124533408 |
| Molecular Formula | C22H18BrClN2O7 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 536.00 |
| IUPAC Name | ethyl 2-[4-[(E)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-chloro-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2\C(=O)NC(=O)N(c3ccc(Br)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C22H18BrClN2O7/c1-3-32-18(27)11-33-19-16(24)9-12(10-17(19)31-2)8-15-20(28)25-22(30)26(21(15)29)14-6-4-13(23)5-7-14/h4-10H,3,11H2,1-2H3,(H,25,28,30)/b15-8+ |
| InChIKey | NSXHFZRCCAOHTN-OVCLIPMQSA-N |
| XLogP | 3.72 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|